C15H29NO4 — CID 123135707
[methyl(2,3,3-trimethylbutanoyloxy)amino] 2,3,3-trimethylbutanoate (PubChem CID 123135707) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is [methyl(2,3,3-trimethylbutanoyloxy)amino] 2,3,3-trimethylbutanoate.
| Compound Name | [methyl(2,3,3-trimethylbutanoyloxy)amino] 2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 123135707 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | [methyl(2,3,3-trimethylbutanoyloxy)amino] 2,3,3-trimethylbutanoate |
| SMILES | CC(C(=O)ON(C)OC(=O)C(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H29NO4/c1-10(14(3,4)5)12(17)19-16(9)20-13(18)11(2)15(6,7)8/h10-11H,1-9H3 |
| InChIKey | QHQUNYPUXNSVRP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|