C11H23NO2 — CID 58646992
1-[(dimethylamino)methoxy]-3,4,4-trimethylpentan-2-one (PubChem CID 58646992) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-[(dimethylamino)methoxy]-3,4,4-trimethylpentan-2-one.
| Compound Name | 1-[(dimethylamino)methoxy]-3,4,4-trimethylpentan-2-one |
|---|---|
| PubChem CID | 58646992 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 1-[(dimethylamino)methoxy]-3,4,4-trimethylpentan-2-one |
| SMILES | CC(C(=O)COCN(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H23NO2/c1-9(11(2,3)4)10(13)7-14-8-12(5)6/h9H,7-8H2,1-6H3 |
| InChIKey | KDAIJURBNGMJGY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|