C9H17NO3 — CID 170609899
N,N-dimethyl-2-(3-methyl-2-oxobutoxy)acetamide (PubChem CID 170609899) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is N,N-dimethyl-2-(3-methyl-2-oxobutoxy)acetamide.
| Compound Name | N,N-dimethyl-2-(3-methyl-2-oxobutoxy)acetamide |
|---|---|
| PubChem CID | 170609899 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | N,N-dimethyl-2-(3-methyl-2-oxobutoxy)acetamide |
| SMILES | CC(C)C(=O)COCC(=O)N(C)C |
| InChI | InChI=1S/C9H17NO3/c1-7(2)8(11)5-13-6-9(12)10(3)4/h7H,5-6H2,1-4H3 |
| InChIKey | PEOAFMNNMNGXJS-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |