C9H19NO3 — CID 172604090
N,N-dimethyl-2-(2-propan-2-yloxyethoxy)acetamide (PubChem CID 172604090) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-propan-2-yloxyethoxy)acetamide.
| Compound Name | N,N-dimethyl-2-(2-propan-2-yloxyethoxy)acetamide |
|---|---|
| PubChem CID | 172604090 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | N,N-dimethyl-2-(2-propan-2-yloxyethoxy)acetamide |
| SMILES | CC(C)OCCOCC(=O)N(C)C |
| InChI | InChI=1S/C9H19NO3/c1-8(2)13-6-5-12-7-9(11)10(3)4/h8H,5-7H2,1-4H3 |
| InChIKey | FHULQTUMXGFNEB-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|