C20H40O6 — CID 163475456
3-methyl-1-[2-(3-methyl-2-oxobutoxy)ethoxy]butan-2-one;2-(2-propan-2-yloxyethoxy)propane (PubChem CID 163475456) has the molecular formula C20H40O6 and a molecular weight of 376.53 g/mol. Its IUPAC name is 3-methyl-1-[2-(3-methyl-2-oxobutoxy)ethoxy]butan-2-one;2-(2-propan-2-yloxyethoxy)propane.
| Compound Name | 3-methyl-1-[2-(3-methyl-2-oxobutoxy)ethoxy]butan-2-one;2-(2-propan-2-yloxyethoxy)propane |
|---|---|
| PubChem CID | 163475456 |
| Molecular Formula | C20H40O6 |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 3-methyl-1-[2-(3-methyl-2-oxobutoxy)ethoxy]butan-2-one;2-(2-propan-2-yloxyethoxy)propane |
| SMILES | CC(C)C(=O)COCCOCC(=O)C(C)C.CC(C)OCCOC(C)C |
| InChI | InChI=1S/C12H22O4.C8H18O2/c1-9(2)11(13)7-15-5-6-16-8-12(14)10(3)4;1-7(2)9-5-6-10-8(3)4/h9-10H,5-8H2,1-4H3;7-8H,5-6H2,1-4H3 |
| InChIKey | BZZPXFVYHQCORP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|