C18H34O7 — CID 171053377
3-[2-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]ethoxy]propyl 2-methylpropanoate (PubChem CID 171053377) has the molecular formula C18H34O7 and a molecular weight of 362.46 g/mol. Its IUPAC name is 3-[2-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]ethoxy]propyl 2-methylpropanoate.
| Compound Name | 3-[2-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]ethoxy]propyl 2-methylpropanoate |
|---|---|
| PubChem CID | 171053377 |
| Molecular Formula | C18H34O7 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 3-[2-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]ethoxy]propyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)COCCOCCOCCOCCCOC(=O)C(C)C |
| InChI | InChI=1S/C18H34O7/c1-15(2)17(19)14-24-13-12-23-11-10-22-9-8-21-6-5-7-25-18(20)16(3)4/h15-16H,5-14H2,1-4H3 |
| InChIKey | ANTQJXQSCOBQNT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|