C15H31NO3S — CID 134582659
3-methyl-1-[3-[5-(1-sulfanylethylamino)pentoxy]propoxy]butan-2-one (PubChem CID 134582659) has the molecular formula C15H31NO3S and a molecular weight of 305.48 g/mol. Its IUPAC name is 3-methyl-1-[3-[5-(1-sulfanylethylamino)pentoxy]propoxy]butan-2-one.
| Compound Name | 3-methyl-1-[3-[5-(1-sulfanylethylamino)pentoxy]propoxy]butan-2-one |
|---|---|
| PubChem CID | 134582659 |
| Molecular Formula | C15H31NO3S |
| Molecular Weight | 305.48 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 3-methyl-1-[3-[5-(1-sulfanylethylamino)pentoxy]propoxy]butan-2-one |
| SMILES | CC(S)NCCCCCOCCCOCC(=O)C(C)C |
| InChI | InChI=1S/C15H31NO3S/c1-13(2)15(17)12-19-11-7-10-18-9-6-4-5-8-16-14(3)20/h13-14,16,20H,4-12H2,1-3H3 |
| InChIKey | OGDRDCDRPNGACR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|