About N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane
N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane (PubChem CID 155752051) has the molecular formula C18H37NO3
and a molecular weight of 315.50 g/mol. Its IUPAC name is N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane.
Molecular Properties
| Compound Name | N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane |
| PubChem CID | 155752051 |
| Molecular Formula | C18H37NO3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.28 |
| IUPAC Name | N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane |
| SMILES | CC(C)C.CC(C)C(=O)COCCCCCCCCNC=O |
| InChI | InChI=1S/C14H27NO3.C4H10/c1-13(2)14(17)11-18-10-8-6-4-3-5-7-9-15-12-16;1-4(2)3/h12-13H,3-11H2,1-2H3,(H,15,16);4H,1-3H3 |
| InChIKey | LUOMNRSTUTXSSI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane?
The IUPAC name of N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane (CID 155752051) is N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane.
What is the SMILES notation for N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane?
The canonical SMILES for N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane is CC(C)C.CC(C)C(=O)COCCCCCCCCNC=O.
What is the InChIKey of N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane?
The InChIKey is LUOMNRSTUTXSSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3.C4H10/c1-13(2)14(17)11-18-10-8-6-4-3-5-7-9-15-12-16;1-4(2)3/h12-13H,3-11H2,1-2H3,(H,15,16);4H,1-3H3.
What are the key properties of N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane?
N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane has a molecular weight of 315.50 g/mol, XLogP of 3.98, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[8-(3-methyl-2-oxobutoxy)octyl]formamide;2-methylpropane is sourced from PubChem (CID 155752051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).