C14H27NO3 — CID 170583801
5-methyl-N-[2-(3-methyl-2-oxobutoxy)ethyl]hexanamide (PubChem CID 170583801) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is 5-methyl-N-[2-(3-methyl-2-oxobutoxy)ethyl]hexanamide.
| Compound Name | 5-methyl-N-[2-(3-methyl-2-oxobutoxy)ethyl]hexanamide |
|---|---|
| PubChem CID | 170583801 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 5-methyl-N-[2-(3-methyl-2-oxobutoxy)ethyl]hexanamide |
| SMILES | CC(C)CCCC(=O)NCCOCC(=O)C(C)C |
| InChI | InChI=1S/C14H27NO3/c1-11(2)6-5-7-14(17)15-8-9-18-10-13(16)12(3)4/h11-12H,5-10H2,1-4H3,(H,15,17) |
| InChIKey | SLIVCZGZDUJSMG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|