C21H40N2O5 — CID 170116965
N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]-6-oxo-9-(propan-2-ylamino)nonanamide (PubChem CID 170116965) has the molecular formula C21H40N2O5 and a molecular weight of 400.56 g/mol. Its IUPAC name is N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]-6-oxo-9-(propan-2-ylamino)nonanamide.
| Compound Name | N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]-6-oxo-9-(propan-2-ylamino)nonanamide |
|---|---|
| PubChem CID | 170116965 |
| Molecular Formula | C21H40N2O5 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | N-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]-6-oxo-9-(propan-2-ylamino)nonanamide |
| SMILES | CC(C)NCCCC(=O)CCCCC(=O)NCCOCCOCC(=O)C(C)C |
| InChI | InChI=1S/C21H40N2O5/c1-17(2)20(25)16-28-15-14-27-13-12-23-21(26)10-6-5-8-19(24)9-7-11-22-18(3)4/h17-18,22H,5-16H2,1-4H3,(H,23,26) |
| InChIKey | DRZWIPYJSKSELI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|