C13H24FNO5 — CID 155751945
N-[2-fluoro-3-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]propyl]formamide (PubChem CID 155751945) has the molecular formula C13H24FNO5 and a molecular weight of 293.33 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]propyl]formamide.
| Compound Name | N-[2-fluoro-3-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]propyl]formamide |
|---|---|
| PubChem CID | 155751945 |
| Molecular Formula | C13H24FNO5 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]propyl]formamide |
| SMILES | CC(C)C(=O)COCCOCCOCC(F)CNC=O |
| InChI | InChI=1S/C13H24FNO5/c1-11(2)13(17)9-20-6-4-18-3-5-19-8-12(14)7-15-10-16/h10-12H,3-9H2,1-2H3,(H,15,16) |
| InChIKey | PRKJEDIVSGLXEC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|