C10H22FN3O4 — CID 164906947
N-[2-fluoro-3-[2-[2-(2-hydrazinylethoxy)ethoxy]ethoxy]propyl]formamide (PubChem CID 164906947) has the molecular formula C10H22FN3O4 and a molecular weight of 267.30 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-(2-hydrazinylethoxy)ethoxy]ethoxy]propyl]formamide.
| Compound Name | N-[2-fluoro-3-[2-[2-(2-hydrazinylethoxy)ethoxy]ethoxy]propyl]formamide |
|---|---|
| PubChem CID | 164906947 |
| Molecular Formula | C10H22FN3O4 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-(2-hydrazinylethoxy)ethoxy]ethoxy]propyl]formamide |
| SMILES | NNCCOCCOCCOCC(F)CNC=O |
| InChI | InChI=1S/C10H22FN3O4/c11-10(7-13-9-15)8-18-6-5-17-4-3-16-2-1-14-12/h9-10,14H,1-8,12H2,(H,13,15) |
| InChIKey | UENTZMIMRRTBRI-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|