C20H43FN2O5 — CID 155707201
N-[2-fluoro-3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]butyl]formamide;2-methylpropane (PubChem CID 155707201) has the molecular formula C20H43FN2O5 and a molecular weight of 410.57 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]butyl]formamide;2-methylpropane.
| Compound Name | N-[2-fluoro-3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]butyl]formamide;2-methylpropane |
|---|---|
| PubChem CID | 155707201 |
| Molecular Formula | C20H43FN2O5 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]butyl]formamide;2-methylpropane |
| SMILES | CC(C)C.CC(C)NCCOCCOCCOCCOC(C)C(F)CNC=O |
| InChI | InChI=1S/C16H33FN2O5.C4H10/c1-14(2)19-4-5-21-6-7-22-8-9-23-10-11-24-15(3)16(17)12-18-13-20;1-4(2)3/h13-16,19H,4-12H2,1-3H3,(H,18,20);4H,1-3H3 |
| InChIKey | FOPXVIKCNJLGKW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|