C10H23N3O2 — CID 142623198
N-[2-[2-[2-(propan-2-ylamino)ethylamino]ethoxy]ethyl]formamide (PubChem CID 142623198) has the molecular formula C10H23N3O2 and a molecular weight of 217.31 g/mol. Its IUPAC name is N-[2-[2-[2-(propan-2-ylamino)ethylamino]ethoxy]ethyl]formamide.
| Compound Name | N-[2-[2-[2-(propan-2-ylamino)ethylamino]ethoxy]ethyl]formamide |
|---|---|
| PubChem CID | 142623198 |
| Molecular Formula | C10H23N3O2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | N-[2-[2-[2-(propan-2-ylamino)ethylamino]ethoxy]ethyl]formamide |
| SMILES | CC(C)NCCNCCOCCNC=O |
| InChI | InChI=1S/C10H23N3O2/c1-10(2)13-4-3-11-5-7-15-8-6-12-9-14/h9-11,13H,3-8H2,1-2H3,(H,12,14) |
| InChIKey | QVJGDBOSIOMEHF-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|