C13H31NO3 — CID 171646622
ethane;2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]acetaldehyde (PubChem CID 171646622) has the molecular formula C13H31NO3 and a molecular weight of 249.39 g/mol. Its IUPAC name is ethane;2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]acetaldehyde.
| Compound Name | ethane;2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]acetaldehyde |
|---|---|
| PubChem CID | 171646622 |
| Molecular Formula | C13H31NO3 |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.23 |
| IUPAC Name | ethane;2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]acetaldehyde |
| SMILES | CC.CC.CC(C)NCCOCCOCC=O |
| InChI | InChI=1S/C9H19NO3.2C2H6/c1-9(2)10-3-5-12-7-8-13-6-4-11;2*1-2/h4,9-10H,3,5-8H2,1-2H3;2*1-2H3 |
| InChIKey | LNJLTCIPTBTHNU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|