C14H32N2O6S — CID 170639490
N-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]methanesulfonamide (PubChem CID 170639490) has the molecular formula C14H32N2O6S and a molecular weight of 356.49 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]methanesulfonamide.
| Compound Name | N-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 170639490 |
| Molecular Formula | C14H32N2O6S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-[2-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]methanesulfonamide |
| SMILES | CC(C)NCCOCCOCCOCCOCCNS(C)(=O)=O |
| InChI | InChI=1S/C14H32N2O6S/c1-14(2)15-4-6-19-8-10-21-12-13-22-11-9-20-7-5-16-23(3,17)18/h14-16H,4-13H2,1-3H3 |
| InChIKey | KEPQYYBGKIGAND-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|