C14H29FN2O4 — CID 153390417
N-[2-fluoro-3-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]propoxy]propyl]formamide (PubChem CID 153390417) has the molecular formula C14H29FN2O4 and a molecular weight of 308.39 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]propoxy]propyl]formamide.
| Compound Name | N-[2-fluoro-3-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]propoxy]propyl]formamide |
|---|---|
| PubChem CID | 153390417 |
| Molecular Formula | C14H29FN2O4 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]propoxy]propyl]formamide |
| SMILES | CC(C)NCCOCCOC(C)COCC(F)CNC=O |
| InChI | InChI=1S/C14H29FN2O4/c1-12(2)17-4-5-19-6-7-21-13(3)9-20-10-14(15)8-16-11-18/h11-14,17H,4-10H2,1-3H3,(H,16,18) |
| InChIKey | XSQURGDYCFRQCN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|