C24H49FN2O6 — CID 157048796
N-[5-[2-[5-(2-fluoro-3-formamidopropoxy)pentoxy]ethoxy]pentyl]-2-propan-2-yloxyacetamide;propane (PubChem CID 157048796) has the molecular formula C24H49FN2O6 and a molecular weight of 480.66 g/mol. Its IUPAC name is N-[5-[2-[5-(2-fluoro-3-formamidopropoxy)pentoxy]ethoxy]pentyl]-2-propan-2-yloxyacetamide;propane.
| Compound Name | N-[5-[2-[5-(2-fluoro-3-formamidopropoxy)pentoxy]ethoxy]pentyl]-2-propan-2-yloxyacetamide;propane |
|---|---|
| PubChem CID | 157048796 |
| Molecular Formula | C24H49FN2O6 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | N-[5-[2-[5-(2-fluoro-3-formamidopropoxy)pentoxy]ethoxy]pentyl]-2-propan-2-yloxyacetamide;propane |
| SMILES | CC(C)OCC(=O)NCCCCCOCCOCCCCCOCC(F)CNC=O.CCC |
| InChI | InChI=1S/C21H41FN2O6.C3H8/c1-19(2)30-17-21(26)24-9-5-3-6-10-27-13-14-28-11-7-4-8-12-29-16-20(22)15-23-18-25;1-3-2/h18-20H,3-17H2,1-2H3,(H,23,25)(H,24,26);3H2,1-2H3 |
| InChIKey | GXFITMDLHYSLEM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|