C21H41FN2O6 — CID 167191221
N-[5-[2-[5-(3-acetamido-2-fluoropropoxy)pentoxy]ethoxy]pentyl]-2-ethoxyacetamide (PubChem CID 167191221) has the molecular formula C21H41FN2O6 and a molecular weight of 436.57 g/mol. Its IUPAC name is N-[5-[2-[5-(3-acetamido-2-fluoropropoxy)pentoxy]ethoxy]pentyl]-2-ethoxyacetamide.
| Compound Name | N-[5-[2-[5-(3-acetamido-2-fluoropropoxy)pentoxy]ethoxy]pentyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 167191221 |
| Molecular Formula | C21H41FN2O6 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | N-[5-[2-[5-(3-acetamido-2-fluoropropoxy)pentoxy]ethoxy]pentyl]-2-ethoxyacetamide |
| SMILES | CCOCC(=O)NCCCCCOCCOCCCCCOCC(F)CNC(C)=O |
| InChI | InChI=1S/C21H41FN2O6/c1-3-27-18-21(26)23-10-6-4-7-11-28-14-15-29-12-8-5-9-13-30-17-20(22)16-24-19(2)25/h20H,3-18H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | VVZUAKMJJMWIEJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|