C12H25FN2O3 — CID 153390576
N-[2-fluoro-3-[3-[3-(methylamino)propoxy]propoxy]propyl]acetamide (PubChem CID 153390576) has the molecular formula C12H25FN2O3 and a molecular weight of 264.34 g/mol. Its IUPAC name is N-[2-fluoro-3-[3-[3-(methylamino)propoxy]propoxy]propyl]acetamide.
| Compound Name | N-[2-fluoro-3-[3-[3-(methylamino)propoxy]propoxy]propyl]acetamide |
|---|---|
| PubChem CID | 153390576 |
| Molecular Formula | C12H25FN2O3 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N-[2-fluoro-3-[3-[3-(methylamino)propoxy]propoxy]propyl]acetamide |
| SMILES | CNCCCOCCCOCC(F)CNC(C)=O |
| InChI | InChI=1S/C12H25FN2O3/c1-11(16)15-9-12(13)10-18-8-4-7-17-6-3-5-14-2/h12,14H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | VVMKSVPIODALSS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|