C15H29FN2O4 — CID 170442191
N-[2-[2-[2-fluoro-3-(2-methylpropanoylamino)propoxy]ethoxy]ethyl]-2-methylpropanamide (PubChem CID 170442191) has the molecular formula C15H29FN2O4 and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[2-[2-[2-fluoro-3-(2-methylpropanoylamino)propoxy]ethoxy]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[2-[2-fluoro-3-(2-methylpropanoylamino)propoxy]ethoxy]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 170442191 |
| Molecular Formula | C15H29FN2O4 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-[2-[2-[2-fluoro-3-(2-methylpropanoylamino)propoxy]ethoxy]ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCOCCOCC(F)CNC(=O)C(C)C |
| InChI | InChI=1S/C15H29FN2O4/c1-11(2)14(19)17-5-6-21-7-8-22-10-13(16)9-18-15(20)12(3)4/h11-13H,5-10H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | HSSHTQIPOVESFR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|