C17H33FN2O6 — CID 156861015
N-[2-fluoro-3-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]propyl]-2-methylbutanamide (PubChem CID 156861015) has the molecular formula C17H33FN2O6 and a molecular weight of 380.46 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]propyl]-2-methylbutanamide.
| Compound Name | N-[2-fluoro-3-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]propyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 156861015 |
| Molecular Formula | C17H33FN2O6 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-[2-[(2-methoxyacetyl)amino]ethoxy]ethoxy]ethoxy]propyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)NCC(F)COCCOCCOCCNC(=O)COC |
| InChI | InChI=1S/C17H33FN2O6/c1-4-14(2)17(22)20-11-15(18)12-26-10-9-25-8-7-24-6-5-19-16(21)13-23-3/h14-15H,4-13H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | FKSDNTLFDKXRHP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|