C15H31FN2O4 — CID 169213803
N-[3-[2-[2-(1-aminopropan-2-yloxy)ethoxy]ethoxy]-2-fluoropropyl]-2-methylbutanamide (PubChem CID 169213803) has the molecular formula C15H31FN2O4 and a molecular weight of 322.42 g/mol. Its IUPAC name is N-[3-[2-[2-(1-aminopropan-2-yloxy)ethoxy]ethoxy]-2-fluoropropyl]-2-methylbutanamide.
| Compound Name | N-[3-[2-[2-(1-aminopropan-2-yloxy)ethoxy]ethoxy]-2-fluoropropyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 169213803 |
| Molecular Formula | C15H31FN2O4 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | N-[3-[2-[2-(1-aminopropan-2-yloxy)ethoxy]ethoxy]-2-fluoropropyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)NCC(F)COCCOCCOC(C)CN |
| InChI | InChI=1S/C15H31FN2O4/c1-4-12(2)15(19)18-10-14(16)11-21-6-5-20-7-8-22-13(3)9-17/h12-14H,4-11,17H2,1-3H3,(H,18,19) |
| InChIKey | VBPRJRRKVMGDNI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|