C14H29FN2O4S — CID 170250557
N-[2-fluoro-3-[2-[2-[1-(methylsulfanylamino)propan-2-yloxy]ethoxy]ethoxy]propyl]propanamide (PubChem CID 170250557) has the molecular formula C14H29FN2O4S and a molecular weight of 340.46 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-[1-(methylsulfanylamino)propan-2-yloxy]ethoxy]ethoxy]propyl]propanamide.
| Compound Name | N-[2-fluoro-3-[2-[2-[1-(methylsulfanylamino)propan-2-yloxy]ethoxy]ethoxy]propyl]propanamide |
|---|---|
| PubChem CID | 170250557 |
| Molecular Formula | C14H29FN2O4S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-[1-(methylsulfanylamino)propan-2-yloxy]ethoxy]ethoxy]propyl]propanamide |
| SMILES | CCC(=O)NCC(F)COCCOCCOC(C)CNSC |
| InChI | InChI=1S/C14H29FN2O4S/c1-4-14(18)16-10-13(15)11-20-6-5-19-7-8-21-12(2)9-17-22-3/h12-13,17H,4-11H2,1-3H3,(H,16,18) |
| InChIKey | FWEXXEWXUJZMPD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|