C14H28FN2O4Y- — CID 155706815
2-[2-[2-[2-fluoro-3-(2-methylpropanoylamino)propoxy]ethoxy]ethoxy]propylazanide;yttrium (PubChem CID 155706815) has the molecular formula C14H28FN2O4Y- and a molecular weight of 396.29 g/mol. Its IUPAC name is 2-[2-[2-[2-fluoro-3-(2-methylpropanoylamino)propoxy]ethoxy]ethoxy]propylazanide;yttrium.
| Compound Name | 2-[2-[2-[2-fluoro-3-(2-methylpropanoylamino)propoxy]ethoxy]ethoxy]propylazanide;yttrium |
|---|---|
| PubChem CID | 155706815 |
| Molecular Formula | C14H28FN2O4Y- |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-[2-[2-[2-fluoro-3-(2-methylpropanoylamino)propoxy]ethoxy]ethoxy]propylazanide;yttrium |
| SMILES | CC(C[NH-])OCCOCCOCC(F)CNC(=O)C(C)C.[Y] |
| InChI | InChI=1S/C14H28FN2O4.Y/c1-11(2)14(18)17-9-13(15)10-20-5-4-19-6-7-21-12(3)8-16;/h11-13,16H,4-10H2,1-3H3,(H,17,18);/q-1; |
| InChIKey | UHCAZEUGANRKSU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|