C13H23F2NO5 — CID 155455184
N-[2-fluoro-3-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]propyl]carbamoyl fluoride (PubChem CID 155455184) has the molecular formula C13H23F2NO5 and a molecular weight of 311.33 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]propyl]carbamoyl fluoride.
| Compound Name | N-[2-fluoro-3-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]propyl]carbamoyl fluoride |
|---|---|
| PubChem CID | 155455184 |
| Molecular Formula | C13H23F2NO5 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]propyl]carbamoyl fluoride |
| SMILES | CC(C)C(=O)COCCOCCOCC(F)CNC(=O)F |
| InChI | InChI=1S/C13H23F2NO5/c1-10(2)12(17)9-21-6-4-19-3-5-20-8-11(14)7-16-13(15)18/h10-11H,3-9H2,1-2H3,(H,16,18) |
| InChIKey | WKTJEQLRZQIXQL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|