C20H40FNO7S — CID 169215028
N-[2-fluoro-3-[2-[2-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]butyl]acetamide;methanethiol (PubChem CID 169215028) has the molecular formula C20H40FNO7S and a molecular weight of 457.61 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]butyl]acetamide;methanethiol.
| Compound Name | N-[2-fluoro-3-[2-[2-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]butyl]acetamide;methanethiol |
|---|---|
| PubChem CID | 169215028 |
| Molecular Formula | C20H40FNO7S |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]ethoxy]ethoxy]butyl]acetamide;methanethiol |
| SMILES | CC(=O)NCC(F)C(C)OCCOCCOCCOCCOCC(=O)C(C)C.CS |
| InChI | InChI=1S/C19H36FNO7.CH4S/c1-15(2)19(23)14-27-10-9-25-6-5-24-7-8-26-11-12-28-16(3)18(20)13-21-17(4)22;1-2/h15-16,18H,5-14H2,1-4H3,(H,21,22);2H,1H3 |
| InChIKey | LJXFSBHPEGZIOR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|