C17H34FNO5 — CID 157113561
N-[2-fluoro-3-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]butyl]-2-methylpropanamide;molecular hydrogen (PubChem CID 157113561) has the molecular formula C17H34FNO5 and a molecular weight of 351.46 g/mol. Its IUPAC name is N-[2-fluoro-3-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]butyl]-2-methylpropanamide;molecular hydrogen.
| Compound Name | N-[2-fluoro-3-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]butyl]-2-methylpropanamide;molecular hydrogen |
|---|---|
| PubChem CID | 157113561 |
| Molecular Formula | C17H34FNO5 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | N-[2-fluoro-3-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethoxy]butyl]-2-methylpropanamide;molecular hydrogen |
| SMILES | CC(C)C(=O)COCCOCCOC(C)C(F)CNC(=O)C(C)C.[H][H] |
| InChI | InChI=1S/C17H32FNO5.H2/c1-12(2)16(20)11-23-7-6-22-8-9-24-14(5)15(18)10-19-17(21)13(3)4;/h12-15H,6-11H2,1-5H3,(H,19,21);1H |
| InChIKey | AHCZNTWBYYPCHK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|