C20H41FN2O6 — CID 163400132
N-[3-[2-[2-[2-[2-[2-(butan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-fluorobutyl]acetamide (PubChem CID 163400132) has the molecular formula C20H41FN2O6 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[3-[2-[2-[2-[2-[2-(butan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-fluorobutyl]acetamide.
| Compound Name | N-[3-[2-[2-[2-[2-[2-(butan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-fluorobutyl]acetamide |
|---|---|
| PubChem CID | 163400132 |
| Molecular Formula | C20H41FN2O6 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | N-[3-[2-[2-[2-[2-[2-(butan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-fluorobutyl]acetamide |
| SMILES | CCC(C)NCCOCCOCCOCCOCCOC(C)C(F)CNC(C)=O |
| InChI | InChI=1S/C20H41FN2O6/c1-5-17(2)22-6-7-25-8-9-26-10-11-27-12-13-28-14-15-29-18(3)20(21)16-23-19(4)24/h17-18,20,22H,5-16H2,1-4H3,(H,23,24) |
| InChIKey | MSWKNNXMAGZUSF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|