C18H37FN2O5 — CID 167242610
N-[3-[2-[2-[2-[2-(ethylamino)ethoxy]ethoxy]ethoxy]ethoxy]-2-fluorobutyl]-2-methylpropanamide (PubChem CID 167242610) has the molecular formula C18H37FN2O5 and a molecular weight of 380.50 g/mol. Its IUPAC name is N-[3-[2-[2-[2-[2-(ethylamino)ethoxy]ethoxy]ethoxy]ethoxy]-2-fluorobutyl]-2-methylpropanamide.
| Compound Name | N-[3-[2-[2-[2-[2-(ethylamino)ethoxy]ethoxy]ethoxy]ethoxy]-2-fluorobutyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 167242610 |
| Molecular Formula | C18H37FN2O5 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | N-[3-[2-[2-[2-[2-(ethylamino)ethoxy]ethoxy]ethoxy]ethoxy]-2-fluorobutyl]-2-methylpropanamide |
| SMILES | CCNCCOCCOCCOCCOC(C)C(F)CNC(=O)C(C)C |
| InChI | InChI=1S/C18H37FN2O5/c1-5-20-6-7-23-8-9-24-10-11-25-12-13-26-16(4)17(19)14-21-18(22)15(2)3/h15-17,20H,5-14H2,1-4H3,(H,21,22) |
| InChIKey | QEABHLCUXDQWPF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|