C10H26N2O2 — CID 172574109
N-[2-[2-(ethylamino)ethoxy]ethyl]-2-methylpropanamide;molecular hydrogen (PubChem CID 172574109) has the molecular formula C10H26N2O2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-[2-[2-(ethylamino)ethoxy]ethyl]-2-methylpropanamide;molecular hydrogen.
| Compound Name | N-[2-[2-(ethylamino)ethoxy]ethyl]-2-methylpropanamide;molecular hydrogen |
|---|---|
| PubChem CID | 172574109 |
| Molecular Formula | C10H26N2O2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | N-[2-[2-(ethylamino)ethoxy]ethyl]-2-methylpropanamide;molecular hydrogen |
| SMILES | CCNCCOCCNC(=O)C(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C10H22N2O2.2H2/c1-4-11-5-7-14-8-6-12-10(13)9(2)3;;/h9,11H,4-8H2,1-3H3,(H,12,13);2*1H |
| InChIKey | FELWXEIPQXRPQC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|