C25H51FN2O6 — CID 170090837
N-[3-[2-[2-[2-[2-[2-(butan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-fluorobutyl]-2-methylhexanamide (PubChem CID 170090837) has the molecular formula C25H51FN2O6 and a molecular weight of 494.69 g/mol. Its IUPAC name is N-[3-[2-[2-[2-[2-[2-(butan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-fluorobutyl]-2-methylhexanamide.
| Compound Name | N-[3-[2-[2-[2-[2-[2-(butan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-fluorobutyl]-2-methylhexanamide |
|---|---|
| PubChem CID | 170090837 |
| Molecular Formula | C25H51FN2O6 |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.37 |
| IUPAC Name | N-[3-[2-[2-[2-[2-[2-(butan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-2-fluorobutyl]-2-methylhexanamide |
| SMILES | CCCCC(C)C(=O)NCC(F)C(C)OCCOCCOCCOCCOCCNC(C)CC |
| InChI | InChI=1S/C25H51FN2O6/c1-6-8-9-21(3)25(29)28-20-24(26)23(5)34-19-18-33-17-16-32-15-14-31-13-12-30-11-10-27-22(4)7-2/h21-24,27H,6-20H2,1-5H3,(H,28,29) |
| InChIKey | BSMIYFYLJNZGJL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|