C19H38N2O5 — CID 59595782
tert-butyl N-[2-[2-[2-(2-methylheptanoylamino)ethoxy]ethoxy]ethyl]carbamate (PubChem CID 59595782) has the molecular formula C19H38N2O5 and a molecular weight of 374.52 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(2-methylheptanoylamino)ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(2-methylheptanoylamino)ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 59595782 |
| Molecular Formula | C19H38N2O5 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(2-methylheptanoylamino)ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CCCCCC(C)C(=O)NCCOCCOCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H38N2O5/c1-6-7-8-9-16(2)17(22)20-10-12-24-14-15-25-13-11-21-18(23)26-19(3,4)5/h16H,6-15H2,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | FNGGSBRCEABMLN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|