C10H20FNO5 — CID 138695823
2-[2-[2-(4-amino-3-fluorobutan-2-yl)oxyethoxy]ethoxy]acetic acid (PubChem CID 138695823) has the molecular formula C10H20FNO5 and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-[2-[2-(4-amino-3-fluorobutan-2-yl)oxyethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-(4-amino-3-fluorobutan-2-yl)oxyethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 138695823 |
| Molecular Formula | C10H20FNO5 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-[2-[2-(4-amino-3-fluorobutan-2-yl)oxyethoxy]ethoxy]acetic acid |
| SMILES | CC(OCCOCCOCC(=O)O)C(F)CN |
| InChI | InChI=1S/C10H20FNO5/c1-8(9(11)6-12)17-5-4-15-2-3-16-7-10(13)14/h8-9H,2-7,12H2,1H3,(H,13,14) |
| InChIKey | ZLIYOOHYKHWKCD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|