C21H43FN2O7 — CID 170533735
tert-butyl N-[4-[2-[2-[2-[2-(4-amino-3-fluorobutan-2-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]butyl]carbamate (PubChem CID 170533735) has the molecular formula C21H43FN2O7 and a molecular weight of 454.58 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[2-[2-[2-(4-amino-3-fluorobutan-2-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[2-[2-[2-(4-amino-3-fluorobutan-2-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]butyl]carbamate |
|---|---|
| PubChem CID | 170533735 |
| Molecular Formula | C21H43FN2O7 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | tert-butyl N-[4-[2-[2-[2-[2-(4-amino-3-fluorobutan-2-yl)oxyethoxy]ethoxy]ethoxy]ethoxy]butyl]carbamate |
| SMILES | CC(OCCOCCOCCOCCOCCCCNC(=O)OC(C)(C)C)C(F)CN |
| InChI | InChI=1S/C21H43FN2O7/c1-18(19(22)17-23)30-16-15-29-14-13-28-12-11-27-10-9-26-8-6-5-7-24-20(25)31-21(2,3)4/h18-19H,5-17,23H2,1-4H3,(H,24,25) |
| InChIKey | HGOHKLGBNZRTNO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|