C11H23FN2O3 — CID 138694050
tert-butyl N-[2-(4-amino-3-fluorobutan-2-yl)oxyethyl]carbamate (PubChem CID 138694050) has the molecular formula C11H23FN2O3 and a molecular weight of 250.31 g/mol. Its IUPAC name is tert-butyl N-[2-(4-amino-3-fluorobutan-2-yl)oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-amino-3-fluorobutan-2-yl)oxyethyl]carbamate |
|---|---|
| PubChem CID | 138694050 |
| Molecular Formula | C11H23FN2O3 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | tert-butyl N-[2-(4-amino-3-fluorobutan-2-yl)oxyethyl]carbamate |
| SMILES | CC(OCCNC(=O)OC(C)(C)C)C(F)CN |
| InChI | InChI=1S/C11H23FN2O3/c1-8(9(12)7-13)16-6-5-14-10(15)17-11(2,3)4/h8-9H,5-7,13H2,1-4H3,(H,14,15) |
| InChIKey | MENHEQNKMHFSMO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|