C14H31N3O3 — CID 102730394
tert-butyl N-[3-amino-2-[2-methoxyethyl(propan-2-yl)amino]propyl]carbamate (PubChem CID 102730394) has the molecular formula C14H31N3O3 and a molecular weight of 289.42 g/mol. Its IUPAC name is tert-butyl N-[3-amino-2-[2-methoxyethyl(propan-2-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-amino-2-[2-methoxyethyl(propan-2-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 102730394 |
| Molecular Formula | C14H31N3O3 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | tert-butyl N-[3-amino-2-[2-methoxyethyl(propan-2-yl)amino]propyl]carbamate |
| SMILES | COCCN(C(C)C)C(CN)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H31N3O3/c1-11(2)17(7-8-19-6)12(9-15)10-16-13(18)20-14(3,4)5/h11-12H,7-10,15H2,1-6H3,(H,16,18) |
| InChIKey | OTUSUHFKUKETLK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |