C16H35N3O3 — CID 102729842
tert-butyl N-[4-amino-3-[butan-2-yl(2-methoxyethyl)amino]butyl]carbamate (PubChem CID 102729842) has the molecular formula C16H35N3O3 and a molecular weight of 317.47 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-[butan-2-yl(2-methoxyethyl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-[butan-2-yl(2-methoxyethyl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 102729842 |
| Molecular Formula | C16H35N3O3 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | tert-butyl N-[4-amino-3-[butan-2-yl(2-methoxyethyl)amino]butyl]carbamate |
| SMILES | CCC(C)N(CCOC)C(CN)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H35N3O3/c1-7-13(2)19(10-11-21-6)14(12-17)8-9-18-15(20)22-16(3,4)5/h13-14H,7-12,17H2,1-6H3,(H,18,20) |
| InChIKey | FINPISKZBJSATN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |