C17H37N3O2 — CID 102729851
tert-butyl N-[4-amino-3-[butan-2-yl(butyl)amino]butyl]carbamate (PubChem CID 102729851) has the molecular formula C17H37N3O2 and a molecular weight of 315.50 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-[butan-2-yl(butyl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-[butan-2-yl(butyl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 102729851 |
| Molecular Formula | C17H37N3O2 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | tert-butyl N-[4-amino-3-[butan-2-yl(butyl)amino]butyl]carbamate |
| SMILES | CCCCN(C(C)CC)C(CN)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H37N3O2/c1-7-9-12-20(14(3)8-2)15(13-18)10-11-19-16(21)22-17(4,5)6/h14-15H,7-13,18H2,1-6H3,(H,19,21) |
| InChIKey | XTYZFFPJKIUZKX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |