C20H41N3O3 — CID 143464647
tert-butyl N-[(3R)-3-[[1-[acetyl(pentyl)amino]-2-methylpropyl]amino]butyl]carbamate (PubChem CID 143464647) has the molecular formula C20H41N3O3 and a molecular weight of 371.57 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-[[1-[acetyl(pentyl)amino]-2-methylpropyl]amino]butyl]carbamate.
| Compound Name | tert-butyl N-[(3R)-3-[[1-[acetyl(pentyl)amino]-2-methylpropyl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 143464647 |
| Molecular Formula | C20H41N3O3 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.31 |
| IUPAC Name | tert-butyl N-[(3R)-3-[[1-[acetyl(pentyl)amino]-2-methylpropyl]amino]butyl]carbamate |
| SMILES | CCCCCN(C(C)=O)C(N[C@H](C)CCNC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C20H41N3O3/c1-9-10-11-14-23(17(5)24)18(15(2)3)22-16(4)12-13-21-19(25)26-20(6,7)8/h15-16,18,22H,9-14H2,1-8H3,(H,21,25)/t16-,18?/m1/s1 |
| InChIKey | REZNXYSFNKSTLB-PYUWXLGESA-N |
| XLogP | 3.90 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|