C14H31N3O2 — CID 164914687
tert-butyl N-[(3R,4R,5R)-4,6-diamino-3-ethyl-5-methylhexyl]carbamate (PubChem CID 164914687) has the molecular formula C14H31N3O2 and a molecular weight of 273.42 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R,5R)-4,6-diamino-3-ethyl-5-methylhexyl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R,5R)-4,6-diamino-3-ethyl-5-methylhexyl]carbamate |
|---|---|
| PubChem CID | 164914687 |
| Molecular Formula | C14H31N3O2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.24 |
| IUPAC Name | tert-butyl N-[(3R,4R,5R)-4,6-diamino-3-ethyl-5-methylhexyl]carbamate |
| SMILES | CC[C@H](CCNC(=O)OC(C)(C)C)[C@@H](N)[C@H](C)CN |
| InChI | InChI=1S/C14H31N3O2/c1-6-11(12(16)10(2)9-15)7-8-17-13(18)19-14(3,4)5/h10-12H,6-9,15-16H2,1-5H3,(H,17,18)/t10-,11-,12+/m1/s1 |
| InChIKey | XXFJZFXTYMPQIG-UTUOFQBUSA-N |
| XLogP | 1.85 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |