C18H31N3O3 — CID 131008134
tert-butyl N-[3-amino-2-[methyl(2-phenylmethoxyethyl)amino]propyl]carbamate (PubChem CID 131008134) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is tert-butyl N-[3-amino-2-[methyl(2-phenylmethoxyethyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-amino-2-[methyl(2-phenylmethoxyethyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 131008134 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | tert-butyl N-[3-amino-2-[methyl(2-phenylmethoxyethyl)amino]propyl]carbamate |
| SMILES | CN(CCOCc1ccccc1)C(CN)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31N3O3/c1-18(2,3)24-17(22)20-13-16(12-19)21(4)10-11-23-14-15-8-6-5-7-9-15/h5-9,16H,10-14,19H2,1-4H3,(H,20,22) |
| InChIKey | AVOALARTPWZFSV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|