C14H25N3O3 — CID 102729720
tert-butyl N-[3-amino-2-[furan-3-ylmethyl(methyl)amino]propyl]carbamate (PubChem CID 102729720) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl N-[3-amino-2-[furan-3-ylmethyl(methyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-amino-2-[furan-3-ylmethyl(methyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 102729720 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | tert-butyl N-[3-amino-2-[furan-3-ylmethyl(methyl)amino]propyl]carbamate |
| SMILES | CN(Cc1ccoc1)C(CN)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25N3O3/c1-14(2,3)20-13(18)16-8-12(7-15)17(4)9-11-5-6-19-10-11/h5-6,10,12H,7-9,15H2,1-4H3,(H,16,18) |
| InChIKey | IMJXLFSVWBNANX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |