C15H32N4O2 — CID 102729450
tert-butyl N-[3-amino-2-[methyl-(1-methylpiperidin-4-yl)amino]propyl]carbamate (PubChem CID 102729450) has the molecular formula C15H32N4O2 and a molecular weight of 300.45 g/mol. Its IUPAC name is tert-butyl N-[3-amino-2-[methyl-(1-methylpiperidin-4-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-amino-2-[methyl-(1-methylpiperidin-4-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 102729450 |
| Molecular Formula | C15H32N4O2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | tert-butyl N-[3-amino-2-[methyl-(1-methylpiperidin-4-yl)amino]propyl]carbamate |
| SMILES | CN1CCC(N(C)C(CN)CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H32N4O2/c1-15(2,3)21-14(20)17-11-13(10-16)19(5)12-6-8-18(4)9-7-12/h12-13H,6-11,16H2,1-5H3,(H,17,20) |
| InChIKey | OWSREAWGTCYAEP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |