C15H31N3O3 — CID 102730363
tert-butyl N-[3-amino-2-[2-(cyclopropylmethoxy)ethyl-methylamino]propyl]carbamate (PubChem CID 102730363) has the molecular formula C15H31N3O3 and a molecular weight of 301.43 g/mol. Its IUPAC name is tert-butyl N-[3-amino-2-[2-(cyclopropylmethoxy)ethyl-methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-amino-2-[2-(cyclopropylmethoxy)ethyl-methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 102730363 |
| Molecular Formula | C15H31N3O3 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | tert-butyl N-[3-amino-2-[2-(cyclopropylmethoxy)ethyl-methylamino]propyl]carbamate |
| SMILES | CN(CCOCC1CC1)C(CN)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H31N3O3/c1-15(2,3)21-14(19)17-10-13(9-16)18(4)7-8-20-11-12-5-6-12/h12-13H,5-11,16H2,1-4H3,(H,17,19) |
| InChIKey | AZUVJFLAXXKADR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|