C14H29N3O2S — CID 102729571
tert-butyl N-[4-amino-3-[methyl(thiolan-3-yl)amino]butyl]carbamate (PubChem CID 102729571) has the molecular formula C14H29N3O2S and a molecular weight of 303.47 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-[methyl(thiolan-3-yl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-[methyl(thiolan-3-yl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 102729571 |
| Molecular Formula | C14H29N3O2S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | tert-butyl N-[4-amino-3-[methyl(thiolan-3-yl)amino]butyl]carbamate |
| SMILES | CN(C(CN)CCNC(=O)OC(C)(C)C)C1CCSC1 |
| InChI | InChI=1S/C14H29N3O2S/c1-14(2,3)19-13(18)16-7-5-11(9-15)17(4)12-6-8-20-10-12/h11-12H,5-10,15H2,1-4H3,(H,16,18) |
| InChIKey | CSONUZIPLKQAIM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |