C17H36N4O2 — CID 102730052
tert-butyl N-[4-amino-3-[3-(diethylamino)pyrrolidin-1-yl]butyl]carbamate (PubChem CID 102730052) has the molecular formula C17H36N4O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-[3-(diethylamino)pyrrolidin-1-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-[3-(diethylamino)pyrrolidin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 102730052 |
| Molecular Formula | C17H36N4O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | tert-butyl N-[4-amino-3-[3-(diethylamino)pyrrolidin-1-yl]butyl]carbamate |
| SMILES | CCN(CC)C1CCN(C(CN)CCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H36N4O2/c1-6-20(7-2)15-9-11-21(13-15)14(12-18)8-10-19-16(22)23-17(3,4)5/h14-15H,6-13,18H2,1-5H3,(H,19,22) |
| InChIKey | JGKAMZVFVIIVJO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |