C15H31N3O2 — CID 102730438
tert-butyl N-[3-amino-2-(3-propan-2-ylpyrrolidin-1-yl)propyl]carbamate (PubChem CID 102730438) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is tert-butyl N-[3-amino-2-(3-propan-2-ylpyrrolidin-1-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-amino-2-(3-propan-2-ylpyrrolidin-1-yl)propyl]carbamate |
|---|---|
| PubChem CID | 102730438 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | tert-butyl N-[3-amino-2-(3-propan-2-ylpyrrolidin-1-yl)propyl]carbamate |
| SMILES | CC(C)C1CCN(C(CN)CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H31N3O2/c1-11(2)12-6-7-18(10-12)13(8-16)9-17-14(19)20-15(3,4)5/h11-13H,6-10,16H2,1-5H3,(H,17,19) |
| InChIKey | GLLJCWQTPBPXQU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |