C14H29N3O4S2 — CID 102730289
tert-butyl N-[4-amino-3-(3-methylsulfonylthiomorpholin-4-yl)butyl]carbamate (PubChem CID 102730289) has the molecular formula C14H29N3O4S2 and a molecular weight of 367.54 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-(3-methylsulfonylthiomorpholin-4-yl)butyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-(3-methylsulfonylthiomorpholin-4-yl)butyl]carbamate |
|---|---|
| PubChem CID | 102730289 |
| Molecular Formula | C14H29N3O4S2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | tert-butyl N-[4-amino-3-(3-methylsulfonylthiomorpholin-4-yl)butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(CN)N1CCSCC1S(C)(=O)=O |
| InChI | InChI=1S/C14H29N3O4S2/c1-14(2,3)21-13(18)16-6-5-11(9-15)17-7-8-22-10-12(17)23(4,19)20/h11-12H,5-10,15H2,1-4H3,(H,16,18) |
| InChIKey | CTFWMEVFCNHART-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |