C9H16N2O2 — CID 104710880
3-amino-2-[furan-3-ylmethyl(methyl)amino]propan-1-ol (PubChem CID 104710880) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-amino-2-[furan-3-ylmethyl(methyl)amino]propan-1-ol.
| Compound Name | 3-amino-2-[furan-3-ylmethyl(methyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 104710880 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 3-amino-2-[furan-3-ylmethyl(methyl)amino]propan-1-ol |
| SMILES | CN(Cc1ccoc1)C(CN)CO |
| InChI | InChI=1S/C9H16N2O2/c1-11(9(4-10)6-12)5-8-2-3-13-7-8/h2-3,7,9,12H,4-6,10H2,1H3 |
| InChIKey | AOOLRYKAXSEDGH-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |